EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O3 |
| Net Charge | 0 |
| Average Mass | 322.489 |
| Monoisotopic Mass | 322.25079 |
| SMILES | O=C(O)CCC/C=C\C/C=C\C/C=C\CCCCCCCCO |
| InChI | InChI=1S/C20H34O3/c21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)23/h1,3-4,6,10,12,21H,2,5,7-9,11,13-19H2,(H,22,23)/b3-1-,6-4-,12-10- |
| InChIKey | LPMWIQNZVQKTBR-DYRGNDFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (18577768) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-HETrE (CHEBI:132324) has functional parent (5Z,8Z,11Z)-icosatrienoic acid (CHEBI:72865) |
| 20-HETrE (CHEBI:132324) has role human xenobiotic metabolite (CHEBI:76967) |
| 20-HETrE (CHEBI:132324) is a HETrE (CHEBI:72793) |
| 20-HETrE (CHEBI:132324) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 20-HETrE (CHEBI:132324) is conjugate acid of 20-HETrE(1−) (CHEBI:132026) |
| Incoming Relation(s) |
| 20-HETrE(1−) (CHEBI:132026) is conjugate base of 20-HETrE (CHEBI:132324) |
| Synonyms | Source |
|---|---|
| 20-hydroxy-(5Z,8Z,11Z)-eicosatrienoic acid | ChEBI |
| 20-hydroxy-(5Z,8Z,11Z)-icosatrienoic acid | ChEBI |
| (5Z,8Z,11Z)-20-hydroxyeicosatrienoic acid | ChEBI |
| (5Z,8Z,11Z)-20-hydroxyicosatrienoic acid | ChEBI |
| Citations |
|---|