EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:132300 |
| ChEBI Name | cyantraniliprole |
| Stars | |
| Definition | A carboxamide that is chlorantraniliprole in which the chlorine atom attached to the phenyl ring has been replaced by a cyano group. A ryanodine receptor agonist, it is used as insecticide for the control of whitefly, thrips, aphids, fruitflies, and fruit worms in crops such as onions, potatoes and tomatoes. It is highly toxic to honeybees. |
| Last Modified | 25 February 2020 |
| Submitter | Gareth Owen |
| Downloads |
| Formula | C19H14BrClN6O2 |
| Net Charge | 0 |
| Average Mass | 473.718 |
| Monoisotopic Mass | 472.00501 |
| SMILES | CNC(=O)c1cc(C#N)cc(C)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C19H14BrClN6O2/c1-10-6-11(9-22)7-12(18(28)23-2)16(10)25-19(29)14-8-15(20)26-27(14)17-13(21)4-3-5-24-17/h3-8H,1-2H3,(H,23,28)(H,25,29) |
| InChIKey | DVBUIBGJRQBEDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | ryanodine receptor agonist A ryanodine receptor modulator which activates the receptor. Ryanodine receptors (RyRs) act as selective ion channels, modulating the release of calcium. Activating the receptors causes the release of calcium, so depleting internal calcium and ultimately preventing further muscle contraction. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyantraniliprole (CHEBI:132300) has role ryanodine receptor agonist (CHEBI:67114) |
| cyantraniliprole (CHEBI:132300) is a nitrile (CHEBI:18379) |
| cyantraniliprole (CHEBI:132300) is a organobromine compound (CHEBI:37141) |
| cyantraniliprole (CHEBI:132300) is a organochlorine compound (CHEBI:36683) |
| cyantraniliprole (CHEBI:132300) is a pyrazole insecticide (CHEBI:26409) |
| cyantraniliprole (CHEBI:132300) is a pyridines (CHEBI:26421) |
| cyantraniliprole (CHEBI:132300) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 3-bromo-1-(3-chloropyridin-2-yl)-N-[4-cyano-2-methyl-6-(methylcarbamoyl)phenyl]-1H-pyrazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| 3-bromo-1-(3-chloro-2-pyridyl)-4'-cyano-2'-methyl-6'-(methylcarbamoyl)pyrazole-5-carboxanilide | Alan Wood's Pesticides |
| 3-bromo-1-(3-chloro-2-pyridinyl)-N-[4-cyano-2-methyl-6-[(methylamino)carbonyl]phenyl]-1H-pyrazole-5-carboxamide | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Zyrox | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| cyantraniliprole | Alan Wood's Pesticides |
| 1662 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11325110 | Reaxys |
| CAS:736994-63-1 | Alan Wood's Pesticides |
| CAS:736994-63-1 | ChemIDplus |
| Citations |
|---|