EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H40 |
| Net Charge | 0 |
| Average Mass | 268.529 |
| Monoisotopic Mass | 268.31300 |
| SMILES | CCCCCCCCCCCC(C)CCCC(C)C |
| InChI | InChI=1S/C19H40/c1-5-6-7-8-9-10-11-12-13-16-19(4)17-14-15-18(2)3/h18-19H,5-17H2,1-4H3 |
| InChIKey | RHDKKTYWDZUSCS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria bassiana (ncbitaxon:176275) | - | PubMed (20233596) | |
| Metarhizium anisopliae (ncbitaxon:5530) | - | PubMed (20233596) | Strain: 406 and 02409 |
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS319) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethylheptadecane (CHEBI:132288) has role fungal metabolite (CHEBI:76946) |
| 2,6-dimethylheptadecane (CHEBI:132288) is a alkane (CHEBI:18310) |
| Manual Xrefs | Databases |
|---|---|
| 474896 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11211963 | Reaxys |
| CAS:54105-67-8 | ChemIDplus |
| Citations |
|---|