EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H30 |
| Net Charge | 0 |
| Average Mass | 198.394 |
| Monoisotopic Mass | 198.23475 |
| SMILES | CCCCCCCCCC(C)CCC |
| InChI | InChI=1S/C14H30/c1-4-6-7-8-9-10-11-13-14(3)12-5-2/h14H,4-13H2,1-3H3 |
| InChIKey | BPHJCXVZYVVFBT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica rapa (ncbitaxon:3711) | - | PubMed (21448706) | |
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS319) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyltridecane (CHEBI:132281) has role plant metabolite (CHEBI:76924) |
| 4-methyltridecane (CHEBI:132281) is a alkane (CHEBI:18310) |
| IUPAC Name |
|---|
| 4-methyltridecane |
| Manual Xrefs | Databases |
|---|---|
| 104846 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1733870 | Reaxys |
| CAS:26730-12-1 | ChemIDplus |
| CAS:26730-12-1 | NIST Chemistry WebBook |
| Citations |
|---|