EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16ClF3O6S |
| Net Charge | 0 |
| Average Mass | 440.823 |
| Monoisotopic Mass | 440.03082 |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c(Cl)c1COCC(F)(F)F |
| InChI | InChI=1S/C17H16ClF3O6S/c1-28(25,26)13-6-5-9(15(18)10(13)7-27-8-17(19,20)21)16(24)14-11(22)3-2-4-12(14)23/h5-6,14H,2-4,7-8H2,1H3 |
| InChIKey | IUQAXCIUEPFPSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tembotrione (CHEBI:132273) has role agrochemical (CHEBI:33286) |
| tembotrione (CHEBI:132273) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| tembotrione (CHEBI:132273) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| tembotrione (CHEBI:132273) has role herbicide (CHEBI:24527) |
| tembotrione (CHEBI:132273) is a aromatic ketone (CHEBI:76224) |
| tembotrione (CHEBI:132273) is a cyclic ketone (CHEBI:3992) |
| tembotrione (CHEBI:132273) is a ether (CHEBI:25698) |
| tembotrione (CHEBI:132273) is a monochlorobenzenes (CHEBI:83403) |
| tembotrione (CHEBI:132273) is a organofluorine compound (CHEBI:37143) |
| tembotrione (CHEBI:132273) is a sulfone (CHEBI:35850) |
| tembotrione (CHEBI:132273) is a β-triketone (CHEBI:140323) |
| IUPAC Name |
|---|
| 2-{2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl}cyclohexane-1,3-dione |
| Synonyms | Source |
|---|---|
| 2-{2-chloro-4-mesyl-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl}cyclohexane-1,3-dione | Alan Wood's Pesticides |
| 2-{2-chloro-4-(methanesulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl}cyclohexane-1,3-dione | Alan Wood's Pesticides |
| 2-[2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl]-1,3-cyclohexanedione | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 1118 | PPDB |
| tembotrione | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322456 | Reaxys |
| CAS:335104-84-2 | Alan Wood's Pesticides |
| CAS:335104-84-2 | ChemIDplus |
| Citations |
|---|