EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4 |
| Net Charge | 0 |
| Average Mass | 176.172 |
| Monoisotopic Mass | 176.07971 |
| SMILES | O=C(O)CNCCNCC(=O)O |
| InChI | InChI=1S/C6H12N2O4/c9-5(10)3-7-1-2-8-4-6(11)12/h7-8H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | IFQUWYZCAGRUJN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agrobacterium sp. (ncbitaxon:361) | - | PubMed (11157232) | Strain: ATCC 55002 |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylenediaminediacetic acid (CHEBI:132240) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| ethylenediaminediacetic acid (CHEBI:132240) has role chelator (CHEBI:38161) |
| ethylenediaminediacetic acid (CHEBI:132240) is a amino dicarboxylic acid (CHEBI:36164) |
| ethylenediaminediacetic acid (CHEBI:132240) is a ethylenediamine derivative (CHEBI:31577) |
| ethylenediaminediacetic acid (CHEBI:132240) is a glycine derivative (CHEBI:24373) |
| ethylenediaminediacetic acid (CHEBI:132240) is a polyamino carboxylic acid (CHEBI:60892) |
| ethylenediaminediacetic acid (CHEBI:132240) is conjugate acid of ethylenediaminediacetate(1−) (CHEBI:131922) |
| Incoming Relation(s) |
| ethylenediaminediacetate(1−) (CHEBI:131922) is conjugate base of ethylenediaminediacetic acid (CHEBI:132240) |
| Synonyms | Source |
|---|---|
| Ethylenediamine-N,N'-di(acetic acid) | ChemIDplus |
| EDDA | ChemIDplus |
| ethylenediamine-N,N'-diacetic acid | ChEBI |
| N,N'-Ethylenediglycine | NIST Chemistry WebBook |
| 1,2-Bis(carboxymethylamino)ethane | NIST Chemistry WebBook |
| ((2-[(Carboxymethyl)amino]ethyl)amino)acetic acid | NIST Chemistry WebBook |
| Citations |
|---|