EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N4O2 |
| Net Charge | 0 |
| Average Mass | 338.411 |
| Monoisotopic Mass | 338.17428 |
| SMILES | C[C@H](C(=O)Nc1cc(C2CC2)nn1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-12(19(25)20-17-11-16(21-22-17)14-4-5-14)13-6-8-15(9-7-13)23-10-2-3-18(23)24/h6-9,11-12,14H,2-5,10H2,1H3,(H2,20,21,22,25)/t12-/m0/s1 |
| InChIKey | UAOIPNOTWOYAMU-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PHA-533533 (CHEBI:132239) has role antineoplastic agent (CHEBI:35610) |
| PHA-533533 (CHEBI:132239) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| PHA-533533 (CHEBI:132239) is a cyclopropanes (CHEBI:51454) |
| PHA-533533 (CHEBI:132239) is a pyrazoles (CHEBI:26410) |
| PHA-533533 (CHEBI:132239) is a pyrrolidin-2-ones (CHEBI:74223) |
| PHA-533533 (CHEBI:132239) is a secondary carboxamide (CHEBI:140325) |
| PHA-533533 (CHEBI:132239) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (2S)-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[4-(2-oxopyrrolidin-1-yl)phenyl]propanamide |
| Synonyms | Source |
|---|---|
| PHA 533533 | ChEBI |
| PHA533533 | ChEBI |
| Citations |
|---|