EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO2 |
| Net Charge | 0 |
| Average Mass | 207.273 |
| Monoisotopic Mass | 207.12593 |
| SMILES | CCN[C@H](C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H17NO2/c1-3-13-9(2)6-10-4-5-11-12(7-10)15-8-14-11/h4-5,7,9,13H,3,6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | PVXVWWANJIWJOO-SECBINFHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3,4-methylenedioxy-N-ethylamphetamine (CHEBI:132235) is a 1-(1,3-benzodioxol-5-yl)-N-ethylpropan-2-amine (CHEBI:132234) |
| (R)-3,4-methylenedioxy-N-ethylamphetamine (CHEBI:132235) is a amphetamines (CHEBI:35338) |
| (R)-3,4-methylenedioxy-N-ethylamphetamine (CHEBI:132235) is enantiomer of (S)-3,4-methylenedioxy-N-ethylamphetamine (CHEBI:132236) |
| Incoming Relation(s) |
| rac-3,4-methylenedioxy-N-ethylamphetamine (CHEBI:132237) has part (R)-3,4-methylenedioxy-N-ethylamphetamine (CHEBI:132235) |
| (S)-3,4-methylenedioxy-N-ethylamphetamine (CHEBI:132236) is enantiomer of (R)-3,4-methylenedioxy-N-ethylamphetamine (CHEBI:132235) |
| IUPAC Name |
|---|
| (2R)-1-(1,3-benzodioxol-5-yl)-N-ethylpropan-2-amine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8767819 | Reaxys |