EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O6 |
| Net Charge | 0 |
| Average Mass | 234.208 |
| Monoisotopic Mass | 234.08519 |
| SMILES | O=C(O)CNCCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C8H14N2O6/c11-6(12)3-9-1-2-10(4-7(13)14)5-8(15)16/h9H,1-5H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | OUDSFQBUEBFSPS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agrobacterium sp. (ncbitaxon:361) | - | PubMed (11157232) | Strain: ATCC 55002 |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylenediaminetriacetic acid (CHEBI:132232) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| ethylenediaminetriacetic acid (CHEBI:132232) has role chelator (CHEBI:38161) |
| ethylenediaminetriacetic acid (CHEBI:132232) is a ethylenediamine derivative (CHEBI:31577) |
| ethylenediaminetriacetic acid (CHEBI:132232) is a glycine derivative (CHEBI:24373) |
| ethylenediaminetriacetic acid (CHEBI:132232) is a polyamino carboxylic acid (CHEBI:60892) |
| ethylenediaminetriacetic acid (CHEBI:132232) is a tricarboxylic acid (CHEBI:27093) |
| ethylenediaminetriacetic acid (CHEBI:132232) is conjugate acid of ethylenediaminetriacetate(2−) (CHEBI:131921) |
| Incoming Relation(s) |
| ethylenediaminetriacetate(2−) (CHEBI:131921) is conjugate base of ethylenediaminetriacetic acid (CHEBI:132232) |
| IUPAC Name |
|---|
| N-{2-[bis(carboxymethyl)amino]ethyl}glycine |
| Synonyms | Source |
|---|---|
| ethylenediamine-N,N,N'-triacetic acid | ChEBI |
| N-(Carboxymethyl)-N-(2-((carboxymethyl)amino)ethyl)glycine | ChemIDplus |
| Citations |
|---|