EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17FN4O4 |
| Net Charge | 0 |
| Average Mass | 348.334 |
| Monoisotopic Mass | 348.12338 |
| SMILES | CN1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn4c3c2OCN4)CC1 |
| InChI | InChI=1S/C16H17FN4O4/c1-19-2-4-20(5-3-19)13-11(17)6-9-12-15(13)25-8-18-21(12)7-10(14(9)22)16(23)24/h6-7,18H,2-5,8H2,1H3,(H,23,24) |
| InChIKey | LPVVTHNMXSEIFM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| marbofloxacin (CHEBI:132230) has role antibacterial drug (CHEBI:36047) |
| marbofloxacin (CHEBI:132230) is a N-alkylpiperazine (CHEBI:46845) |
| marbofloxacin (CHEBI:132230) is a fluoroquinolone antibiotic (CHEBI:87211) |
| marbofloxacin (CHEBI:132230) is a monocarboxylic acid (CHEBI:25384) |
| marbofloxacin (CHEBI:132230) is a monofluorobenzenes (CHEBI:83575) |
| IUPAC Name |
|---|
| 9-fluoro-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,3,4]oxadiazino[6,5,4-ij]quinoline-6-carboxylic acid |
| INNs | Source |
|---|---|
| marbofloxacin | ChemIDplus |
| marbofloxacine | ChemIDplus |
| marbofloxacino | ChemIDplus |
| marbofloxacinum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Marbofloxacin | Wikipedia |
| LSM-5799 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:115550-35-1 | ChemIDplus |
| Citations |
|---|