EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO5S |
| Net Charge | 0 |
| Average Mass | 183.185 |
| Monoisotopic Mass | 183.02014 |
| SMILES | N[C@@H](CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C4H9NO5S/c5-3(4(6)7)1-2-11(8,9)10/h3H,1-2,5H2,(H,6,7)(H,8,9,10)/t3-/m0/s1 |
| InChIKey | VBOQYPQEPHKASR-VKHMYHEASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| Application: | NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homocysteic acid (CHEBI:132223) has role NMDA receptor agonist (CHEBI:64571) |
| L-homocysteic acid (CHEBI:132223) is a homocysteic acid (CHEBI:90324) |
| L-homocysteic acid (CHEBI:132223) is enantiomer of D-homocysteic acid (CHEBI:132225) |
| Incoming Relation(s) |
| DL-homocysteic acid (CHEBI:132221) has part L-homocysteic acid (CHEBI:132223) |
| D-homocysteic acid (CHEBI:132225) is enantiomer of L-homocysteic acid (CHEBI:132223) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-sulfobutanoic acid |
| Synonyms | Source |
|---|---|
| L-2-amino-4-sulfobutyric acid | HMDB |
| (S)-2-amino-4-sulfobutyric acid | ChEBI |
| (S)-2-amino-4-sulfobutanoic acid | ChEBI |
| (2S)-2-amino-4-sulfobutyric acid | ChEBI |
| homocysteic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16511 | KEGG COMPOUND |
| HMDB0002205 | HMDB |
| Homocysteic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5735822 | Reaxys |
| CAS:14857-77-3 | KEGG COMPOUND |
| CAS:14857-77-3 | ChemIDplus |
| Citations |
|---|