EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5O10P2 |
| Net Charge | 0 |
| Average Mass | 427.203 |
| Monoisotopic Mass | 427.02941 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | XTWYTFMLZFPYCI-KQYNXXCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ADP (CHEBI:16761) has role fundamental metabolite (CHEBI:78675) |
| ADP (CHEBI:16761) has role human metabolite (CHEBI:77746) |
| ADP (CHEBI:16761) is a adenosine 5'-phosphate (CHEBI:37096) |
| ADP (CHEBI:16761) is a purine ribonucleoside 5'-diphosphate (CHEBI:37038) |
| ADP (CHEBI:16761) is conjugate acid of ADP(2−) (CHEBI:87518) |
| ADP (CHEBI:16761) is conjugate acid of ADP(3−) (CHEBI:456216) |
| Incoming Relation(s) |
| N6-(dimethylallyl)adenosine 5'-diphosphate (CHEBI:71678) has functional parent ADP (CHEBI:16761) |
| 1,3-selenazole-4-carboxamide adenine dinucleotide (CHEBI:47669) has functional parent ADP (CHEBI:16761) |
| 3'-O-(N-methylanthraniloyl)adenosine 5'-diphosphate (CHEBI:71336) has functional parent ADP (CHEBI:16761) |
| 3'-phosphate-adenosine-5'-diphosphate (CHEBI:44672) has functional parent ADP (CHEBI:16761) |
| 9-ribosyl-trans-zeatin 5'-diphosphate (CHEBI:71875) has functional parent ADP (CHEBI:16761) |
| ADP orthovanadate (CHEBI:144716) has functional parent ADP (CHEBI:16761) |
| ADP-D-ribose (CHEBI:16960) has functional parent ADP (CHEBI:16761) |
| ADP-5-ethyl-4-methylthiazole-2-carboxylic acid (CHEBI:134399) has functional parent ADP (CHEBI:16761) |
| ADP-sugar (CHEBI:35239) has functional parent ADP (CHEBI:16761) |
| ADP(2−) (CHEBI:87518) is conjugate base of ADP (CHEBI:16761) |
| ADP(3−) (CHEBI:456216) is conjugate base of ADP (CHEBI:16761) |
| IUPAC Name |
|---|
| adenosine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| ADP | KEGG COMPOUND |
| Adenosine 5'-diphosphate | KEGG COMPOUND |
| ADENOSINE-5'-DIPHOSPHATE | PDBeChem |
| H3adp | IUPAC |
| 5'-adenylphosphoric acid | ChemIDplus |
| Citations |
|---|