EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132202 - (2R)-CDP-glycerol
| Formula | C12H21N3O13P2 |
| Net Charge | 0 |
| Average Mass | 477.256 |
| Monoisotopic Mass | 477.05496 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H](O)CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C12H21N3O13P2/c13-8-1-2-15(12(20)14-8)11-10(19)9(18)7(27-11)5-26-30(23,24)28-29(21,22)25-4-6(17)3-16/h1-2,6-7,9-11,16-19H,3-5H2,(H,21,22)(H,23,24)(H2,13,14,20)/t6-,7-,9-,10-,11-/m1/s1 |
| InChIKey | HHPOUCCVONEPRK-JBSYKWBFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-CDP-glycerol (CHEBI:132202) is a CDP-glycerol (CHEBI:17885) |
| (2R)-CDP-glycerol (CHEBI:132202) is conjugate acid of (2R)-CDP-glycerol(2−) (CHEBI:58311) |
| Incoming Relation(s) |
| (2R)-CDP-glycerol(2−) (CHEBI:58311) is conjugate base of (2R)-CDP-glycerol (CHEBI:132202) |
| IUPAC Name |
|---|
| 5'-O-[({[(2R)-2,3-dihydroxypropoxy](hydroxy)phosphoryl}oxy)(hydroxy)phosphoryl]cytidine |
| Synonyms | Source |
|---|---|
| cytidine 5'-{3-[(2R)-2,3-dihydroxypropyl] dihydrogen diphosphate} | ChEBI |
| (2R)-cytidine 5'-diphosphate glycerol | ChEBI |
| (2R)-cytidine diphosphate glycerol | ChEBI |