EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15NO2 |
| Net Charge | 0 |
| Average Mass | 133.191 |
| Monoisotopic Mass | 133.11028 |
| SMILES | CCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3 |
| InChIKey | AKNUHUCEWALCOI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (12587675) | |
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS319) | |
| Rattus norvegicus (ncbitaxon:10116) | urine (BTO:0001419) | PubMed (15239850) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-ethyldiethanolamine (CHEBI:132187) has functional parent ethanolamine (CHEBI:16000) |
| N-ethyldiethanolamine (CHEBI:132187) has role human urinary metabolite (CHEBI:84087) |
| N-ethyldiethanolamine (CHEBI:132187) has role human xenobiotic metabolite (CHEBI:76967) |
| N-ethyldiethanolamine (CHEBI:132187) has role rat metabolite (CHEBI:86264) |
| N-ethyldiethanolamine (CHEBI:132187) is a aminodiol (CHEBI:22501) |
| N-ethyldiethanolamine (CHEBI:132187) is a primary alcohol (CHEBI:15734) |
| N-ethyldiethanolamine (CHEBI:132187) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2,2'-(ethylazanediyl)di(ethan-1-ol) |
| Synonyms | Source |
|---|---|
| 2,2'-(Ethylazanediyl)diethanol | NIST Chemistry WebBook |
| 2,2'-(Ethylimino)bisethanol | ChemIDplus |
| 2,2'-(ethylimino)diethanol | ChEBI |
| 2-(N-Ethyl-N-2-hydroxyethylamino)ethanol | ChemIDplus |
| Diethanolethylamine | ChemIDplus |
| Ethylbis(2-hydroxyethyl)amine | ChemIDplus |
| Citations |
|---|