EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO |
| Net Charge | 0 |
| Average Mass | 165.236 |
| Monoisotopic Mass | 165.11536 |
| SMILES | CN[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10-/m0/s1 |
| InChIKey | KWGRBVOPPLSCSI-WPRPVWTQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ephedra equisetina (ncbitaxon:173280) | - | PubMed (21465337) | |
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS319) |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. vasoconstrictor agent Drug used to cause constriction of the blood vessels. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-ephedrine (CHEBI:15407) has role bacterial metabolite (CHEBI:76969) |
| (−)-ephedrine (CHEBI:15407) has role environmental contaminant (CHEBI:78298) |
| (−)-ephedrine (CHEBI:15407) has role nasal decongestant (CHEBI:77715) |
| (−)-ephedrine (CHEBI:15407) has role plant metabolite (CHEBI:76924) |
| (−)-ephedrine (CHEBI:15407) has role sympathomimetic agent (CHEBI:35524) |
| (−)-ephedrine (CHEBI:15407) has role vasoconstrictor agent (CHEBI:50514) |
| (−)-ephedrine (CHEBI:15407) has role xenobiotic (CHEBI:35703) |
| (−)-ephedrine (CHEBI:15407) is a phenethylamine alkaloid (CHEBI:38605) |
| (−)-ephedrine (CHEBI:15407) is a phenylethanolamines (CHEBI:25990) |
| (−)-ephedrine (CHEBI:15407) is conjugate base of (−)-ephedrinium (CHEBI:57295) |
| Incoming Relation(s) |
| (−)-ephedrinium (CHEBI:57295) is conjugate acid of (−)-ephedrine (CHEBI:15407) |
| IUPAC Name |
|---|
| (1R,2S)-2-(methylamino)-1-phenylpropan-1-ol |
| Synonyms | Source |
|---|---|
| (1R,2S)-1-phenyl-1-hydroxy-2-methylaminopropane | ChEBI |
| l-ephedrine | ChemIDplus |
| (-)-Ephedrine | KEGG COMPOUND |
| Ephedrine | KEGG COMPOUND |
| L-Ephedrine | KEGG COMPOUND |
| L(−)-ephedrine | ChemIDplus |
| Citations |
|---|