EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O |
| Net Charge | 0 |
| Average Mass | 288.475 |
| Monoisotopic Mass | 288.24532 |
| SMILES | CC1=C(CC/C(C)=C/C=C/C(C)=C/CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H32O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,13,21H,7,10-12,14-15H2,1-5H3/b9-6+,16-8+,17-13+ |
| InChIKey | XEMSPUZLYVPKPX-SHGBQBHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Danio rerio (ncbitaxon:7955) | - | PubMed (17253779) |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-7,8-dihydroretinol (CHEBI:132173) has role marine xenobiotic metabolite (CHEBI:83399) |
| all-trans-7,8-dihydroretinol (CHEBI:132173) is a primary alcohol (CHEBI:15734) |
| all-trans-7,8-dihydroretinol (CHEBI:132173) is a retinoid (CHEBI:26537) |
| IUPAC Name |
|---|
| 7,8-dihydroretinol |
| Synonym | Source |
|---|---|
| (2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6-trien-1-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| all-trans-7,8-dihydroretinol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22648242 | Reaxys |
| CAS:115797-12-1 | ChemIDplus |
| Citations |
|---|