EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O5 |
| Net Charge | 0 |
| Average Mass | 160.125 |
| Monoisotopic Mass | 160.03717 |
| SMILES | C[C@H](O)C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C6H8O5/c1-3(7)4(8)2-5(9)6(10)11/h3,7H,2H2,1H3,(H,10,11)/t3-/m0/s1 |
| InChIKey | CQZFXXYDOLONCO-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sulfobacillus thermosulfidooxidans (ncbitaxon:28034) | - | PubMed (25617114) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-didehydro-3-deoxy-L-rhamnonic acid (CHEBI:132125) has functional parent rhamnonic acid (CHEBI:21376) |
| 2,4-didehydro-3-deoxy-L-rhamnonic acid (CHEBI:132125) has role bacterial metabolite (CHEBI:76969) |
| 2,4-didehydro-3-deoxy-L-rhamnonic acid (CHEBI:132125) is a hexonic acid (CHEBI:33752) |
| 2,4-didehydro-3-deoxy-L-rhamnonic acid (CHEBI:132125) is a ketoaldonic acid (CHEBI:24963) |
| 2,4-didehydro-3-deoxy-L-rhamnonic acid (CHEBI:132125) is conjugate acid of 2,4-didehydro-3-deoxy-L-rhamnonate (CHEBI:131847) |
| Incoming Relation(s) |
| 2,4-didehydro-3-deoxy-L-rhamnonate (CHEBI:131847) is conjugate base of 2,4-didehydro-3-deoxy-L-rhamnonic acid (CHEBI:132125) |
| IUPAC Name |
|---|
| (5S)-5-hydroxy-2,4-dioxohexanoic acid |
| Synonym | Source |
|---|---|
| L-2,4-diketo-3-deoxyrhamnonic acid | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-13044 | MetaCyc |
| Citations |
|---|