EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O7S |
| Net Charge | 0 |
| Average Mass | 389.430 |
| Monoisotopic Mass | 389.12567 |
| SMILES | [H]C(=O)C(C)(C=C)SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H23N3O7S/c1-3-15(2,8-19)26-7-10(13(23)17-6-12(21)22)18-11(20)5-4-9(16)14(24)25/h3,8-10H,1,4-7,16H2,2H3,(H,17,23)(H,18,20)(H,21,22)(H,24,25)/t9-,10-,15?/m0/s1 |
| InChIKey | KTSZDHMDBQVCIB-WUAMPTBBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(2-methyl-1-oxobut-3-en-2-yl)glutathione (CHEBI:132122) is a glutathione derivative (CHEBI:24337) |
| S-(2-methyl-1-oxobut-3-en-2-yl)glutathione (CHEBI:132122) is conjugate acid of S-(2-methyl-1-oxobut-3-en-2-yl)glutathione(1−) (CHEBI:131798) |
| Incoming Relation(s) |
| S-(2-methyl-1-oxobut-3-en-2-yl)glutathione(1−) (CHEBI:131798) is conjugate base of S-(2-methyl-1-oxobut-3-en-2-yl)glutathione (CHEBI:132122) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-(2-methyl-1-oxobut-3-en-2-yl)-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| 2-glutathionyl-2-methylbut-3-enal | MetaCyc |
| S-(2-formyl-2-methylbut-3-en-2-yl)glutathione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19031 | MetaCyc |
| Citations |
|---|