EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O8S |
| Net Charge | 0 |
| Average Mass | 405.429 |
| Monoisotopic Mass | 405.12059 |
| SMILES | C=CC(C)(SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H23N3O8S/c1-3-15(2,14(25)26)27-7-9(12(22)17-6-11(20)21)18-10(19)5-4-8(16)13(23)24/h3,8-9H,1,4-7,16H2,2H3,(H,17,22)(H,18,19)(H,20,21)(H,23,24)(H,25,26)/t8-,9-,15?/m0/s1 |
| InChIKey | GPWMCZLMCJWORL-KZGJKODISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(2-carboxy-2-methylbut-3-en-2-yl)glutathione (CHEBI:132118) is a glutathione derivative (CHEBI:24337) |
| S-(2-carboxy-2-methylbut-3-en-2-yl)glutathione (CHEBI:132118) is conjugate acid of S-(2-carboxy-2-methylbut-3-en-2-yl)glutathione(2−) (CHEBI:131797) |
| Incoming Relation(s) |
| S-(2-carboxy-2-methylbut-3-en-2-yl)glutathione(2−) (CHEBI:131797) is conjugate base of S-(2-carboxy-2-methylbut-3-en-2-yl)glutathione (CHEBI:132118) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-(2-carboxybut-3-en-2-yl)-L-cysteinylglycine |
| Synonym | Source |
|---|---|
| 2-glutathionyl-2-methylbut-3-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19032 | MetaCyc |
| Citations |
|---|