EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13NO3 |
| Net Charge | 0 |
| Average Mass | 219.240 |
| Monoisotopic Mass | 219.08954 |
| SMILES | C[C@H](c1cnc2ccccc12)[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H13NO3/c1-7(11(14)12(15)16)9-6-13-10-5-3-2-4-8(9)10/h2-7,11,13-14H,1H3,(H,15,16)/t7-,11+/m1/s1 |
| InChIKey | NUFXPJOTSOMKFZ-HQJQHLMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseus (ncbitaxon:1911) | - | PubMed (5447649) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indolmycenic acid (CHEBI:132117) has role bacterial metabolite (CHEBI:76969) |
| indolmycenic acid (CHEBI:132117) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| indolmycenic acid (CHEBI:132117) is a indol-3-yl carboxylic acid (CHEBI:24810) |
| indolmycenic acid (CHEBI:132117) is conjugate acid of indolmycenate (CHEBI:131783) |
| Incoming Relation(s) |
| indolmycenate (CHEBI:131783) is conjugate base of indolmycenic acid (CHEBI:132117) |
| IUPAC Name |
|---|
| (2S,3R)-2-hydroxy-3-(1H-indol-3-yl)butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-18934 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:479130 | Reaxys |
| Citations |
|---|