EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5O2.Na |
| Net Charge | 0 |
| Average Mass | 96.061 |
| Monoisotopic Mass | 96.01872 |
| SMILES | CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O2.Na/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 |
| InChIKey | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. |
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium propionate (CHEBI:132106) has part propionate (CHEBI:17272) |
| sodium propionate (CHEBI:132106) has role antifungal drug (CHEBI:86327) |
| sodium propionate (CHEBI:132106) has role food preservative (CHEBI:65255) |
| sodium propionate (CHEBI:132106) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium propanoate |
| Synonyms | Source |
|---|---|
| E281 | ChEBI |
| Natriumpropionat | ChemIDplus |
| Propanoic acid, sodium salt | ChemIDplus |
| Propionic acid sodium salt | ChemIDplus |
| Sodium propionate anhydrous | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08440 | KEGG DRUG |
| Sodium_propionate | Wikipedia |
| Citations |
|---|