EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3O3.Na |
| Net Charge | 0 |
| Average Mass | 98.033 |
| Monoisotopic Mass | 97.99799 |
| SMILES | O=C([O-])CO.[Na+] |
| InChI | InChI=1S/C2H4O3.Na/c3-1-2(4)5;/h3H,1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | VILMUCRZVVVJCA-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium glycolate (CHEBI:132094) has part glycolate (CHEBI:29805) |
| sodium glycolate (CHEBI:132094) has role keratolytic drug (CHEBI:50176) |
| sodium glycolate (CHEBI:132094) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium hydroxyacetate |
| Synonyms | Source |
|---|---|
| Glycolic acid, monosodium salt | ChemIDplus |
| Glycolic acid, sodium salt | ChemIDplus |
| Hydroxyacetic acid, monosodium salt | ChemIDplus |
| Monosodium glycolate | ChemIDplus |
| Natriumglykolat | ChemIDplus |
| Sodium 2-hydroxyacetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3914916 | Reaxys |
| CAS:2836-32-0 | ChemIDplus |