EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O3 |
| Net Charge | -1 |
| Average Mass | 317.449 |
| Monoisotopic Mass | 317.21222 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h3-5,8-11,13-14,17,19,21H,2,6-7,12,15-16,18H2,1H3,(H,22,23)/p-1/b5-4-,10-8-,11-9-,13-3-,17-14+/t19-/m0/s1 |
| InChIKey | WLKCSMCLEKGITB-DBVSHIMFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15(S)-HEPE(1−) (CHEBI:132087) is a HEPE(1−) (CHEBI:131874) |
| 15(S)-HEPE(1−) (CHEBI:132087) is a long-chain fatty acid anion (CHEBI:57560) |
| 15(S)-HEPE(1−) (CHEBI:132087) is conjugate base of 15(S)-HEPE (CHEBI:88347) |
| 15(S)-HEPE(1−) (CHEBI:132087) is enantiomer of 15(R)-HEPE(1−) (CHEBI:90819) |
| Incoming Relation(s) |
| 15(S)-HEPE (CHEBI:88347) is conjugate acid of 15(S)-HEPE(1−) (CHEBI:132087) |
| 15(R)-HEPE(1−) (CHEBI:90819) is enantiomer of 15(S)-HEPE(1−) (CHEBI:132087) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,13E,15S,17Z)-15-hydroxyicosa-5,8,11,13,17-pentaenoate |
| Synonyms | Source |
|---|---|
| 15S-HEPE(1−) | SUBMITTER |
| (15S)-hydroxy-(5Z,8Z,11Z,13E,17Z)-icosapentaenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (15S)-hydroxy-(5Z,8Z,11Z,13E,17Z)-eicosapentaenoate | UniProt |
| Citations |
|---|