EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H24O2 |
| Net Charge | 0 |
| Average Mass | 404.509 |
| Monoisotopic Mass | 404.17763 |
| SMILES | CC1(C)CC=C(C#Cc2ccccc2)c2cc(/C=C/c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C29H24O2/c1-29(2)19-18-24(14-10-21-6-4-3-5-7-21)26-20-23(13-17-27(26)29)9-8-22-11-15-25(16-12-22)28(30)31/h3-9,11-13,15-18,20H,19H2,1-2H3,(H,30,31)/b9-8+ |
| InChIKey | YCADIXLLWMXYKW-CMDGGOBGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | retinoic acid receptor antagonist An antagonist that acts at the retinoic acid receptor. |
| Application: | retinoic acid receptor antagonist An antagonist that acts at the retinoic acid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BMS-493 (CHEBI:132086) has role retinoic acid receptor antagonist (CHEBI:90714) |
| BMS-493 (CHEBI:132086) is a acetylenic compound (CHEBI:73474) |
| BMS-493 (CHEBI:132086) is a benzoic acids (CHEBI:22723) |
| BMS-493 (CHEBI:132086) is a dihydronaphthalenes (CHEBI:90740) |
| BMS-493 (CHEBI:132086) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 4-{(E)-2-[5,5-dimethyl-8-(phenylethynyl)-5,6-dihydronaphthalen-2-yl]ethenyl}benzoic acid |
| Synonyms | Source |
|---|---|
| BMS 493 | ChEBI |
| BMS493 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15383782 | Reaxys |
| Citations |
|---|