EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O3S |
| Net Charge | 0 |
| Average Mass | 300.384 |
| Monoisotopic Mass | 300.12561 |
| SMILES | CNCc1ccc(CSCCNC(=C[N+](=O)[O-])NC)o1 |
| InChI | InChI=1S/C12H20N4O3S/c1-13-7-10-3-4-11(19-10)9-20-6-5-15-12(14-2)8-16(17)18/h3-4,8,13-15H,5-7,9H2,1-2H3 |
| InChIKey | WZLBVRXZNDXPPW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (6281996) | ||
| - | MetaboLights (MTBLS307) | ||
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (7645303) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmethylranitidine (CHEBI:132051) has role drug metabolite (CHEBI:49103) |
| desmethylranitidine (CHEBI:132051) has role human urinary metabolite (CHEBI:84087) |
| desmethylranitidine (CHEBI:132051) has role rat metabolite (CHEBI:86264) |
| desmethylranitidine (CHEBI:132051) is a C-nitro compound (CHEBI:35716) |
| desmethylranitidine (CHEBI:132051) is a furans (CHEBI:24129) |
| desmethylranitidine (CHEBI:132051) is a organic sulfide (CHEBI:16385) |
| desmethylranitidine (CHEBI:132051) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N1-methyl-N'1-{2-[({5-[(methylamino)methyl]furan-2-yl}methyl)sulfanyl]ethyl}-2-nitroethene-1,1-diamine |
| Synonyms | Source |
|---|---|
| 5-Desmethylranitidine | ChemIDplus |
| desmethyl ranitidine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8555507 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6425877 | Reaxys |
| CAS:66357-25-3 | ChemIDplus |
| Citations |
|---|