EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28N2O5 |
| Net Charge | 0 |
| Average Mass | 340.420 |
| Monoisotopic Mass | 340.19982 |
| SMILES | [H][C@@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCC)C(=O)O)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C17H28N2O5/c1-3-6-12(16(21)22)18-10(2)15(20)19-13-8-5-4-7-11(13)9-14(19)17(23)24/h10-14,18H,3-9H2,1-2H3,(H,21,22)(H,23,24)/t10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | ODAIHABQVKJNIY-PEDHHIEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS307) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perindoprilat (CHEBI:132041) has role antihypertensive agent (CHEBI:35674) |
| perindoprilat (CHEBI:132041) has role drug metabolite (CHEBI:49103) |
| perindoprilat (CHEBI:132041) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| perindoprilat (CHEBI:132041) is a L-alanine derivative (CHEBI:83943) |
| perindoprilat (CHEBI:132041) is a dicarboxylic acid (CHEBI:35692) |
| perindoprilat (CHEBI:132041) is a dipeptide (CHEBI:46761) |
| perindoprilat (CHEBI:132041) is a organic heterobicyclic compound (CHEBI:27171) |
| IUPAC Name |
|---|
| N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvaline |
| INNs | Source |
|---|---|
| perindoprilate | ChemIDplus |
| perindoprilato | ChemIDplus |
| perindoprilatum | ChemIDplus |
| perondropilat | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,3aS,7aS)-1-[(2S)-2-{[(1S)-1-carboxybutyl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid | IUPAC |
| S 9780 | ChemIDplus |
| S-9780 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060574 | HMDB |
| X94 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4207072 | Reaxys |
| CAS:95153-31-4 | ChemIDplus |
| Citations |
|---|