EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O3 |
| Net Charge | -1 |
| Average Mass | 343.487 |
| Monoisotopic Mass | 343.22787 |
| SMILES | CC(O)/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)[O-] |
| InChI | InChI=1S/C22H32O3/c1-21(23)19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-22(24)25/h2,4-5,7-8,10-11,13-14,16-17,19,21,23H,3,6,9,12,15,18,20H2,1H3,(H,24,25)/p-1/b4-2-,7-5-,10-8-,13-11-,16-14-,19-17- |
| InChIKey | IXAMNXQQWDOFMN-NZONWQNASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 21-HDoHE(1−) (CHEBI:132025) is a (ω−1)-hydroxy fatty acid anion (CHEBI:84497) |
| 21-HDoHE(1−) (CHEBI:132025) is a hydroxydocosahexaenoate (CHEBI:131867) |
| 21-HDoHE(1−) (CHEBI:132025) is a long-chain fatty acid anion (CHEBI:57560) |
| 21-HDoHE(1−) (CHEBI:132025) is conjugate base of 21-HDoHE (CHEBI:132325) |
| Incoming Relation(s) |
| 21-HDoHE (CHEBI:132325) is conjugate acid of 21-HDoHE(1−) (CHEBI:132025) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z,13Z,16Z,19Z)-21-hydroxydocosa-4,7,10,13,16,19-hexaenoate |
| Synonyms | Source |
|---|---|
| 21-HDHA(1−) | SUBMITTER |
| (4Z,7Z,10Z,13Z,16Z,19Z)-21-hydroxydocosahexaenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 21-hydroxy-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate | UniProt |
| Citations |
|---|