EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O3 |
| Net Charge | -1 |
| Average Mass | 321.481 |
| Monoisotopic Mass | 321.24352 |
| SMILES | CC(O)CCCCCC/C=C\C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H34O3/c1-19(21)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20(22)23/h3-6,10,12,19,21H,2,7-9,11,13-18H2,1H3,(H,22,23)/p-1/b5-3-,6-4-,12-10- |
| InChIKey | GXGFNSDOYGEKLT-OFROGHSZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-HETrE(1−) (CHEBI:132024) is a (ω−1)-hydroxy fatty acid anion (CHEBI:84497) |
| 19-HETrE(1−) (CHEBI:132024) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| 19-HETrE(1−) (CHEBI:132024) is a icosanoid anion (CHEBI:62937) |
| 19-HETrE(1−) (CHEBI:132024) is a long-chain fatty acid anion (CHEBI:57560) |
| 19-HETrE(1−) (CHEBI:132024) is conjugate base of 19-HETrE (CHEBI:132323) |
| Incoming Relation(s) |
| 19-HETrE (CHEBI:132323) is conjugate acid of 19-HETrE(1−) (CHEBI:132024) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z)-19-hydroxyicosa-5,8,11-trienoate |
| Synonyms | Source |
|---|---|
| 19-hydroxy-(5Z,8Z,11Z)-icosatrienoate | ChEBI |
| 19-hydroxy-ETA(1−) | SUBMITTER |
| (5Z,8Z,11Z)-19-hydroxyeicosatrienoate | ChEBI |
| (5Z,8Z,11Z)-19-hydroxyicosatrienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 19-hydroxy-(5Z,8Z,11Z)-eicosatrienoate | UniProt |
| Citations |
|---|