EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9N2O2 |
| Net Charge | -1 |
| Average Mass | 225.227 |
| Monoisotopic Mass | 225.06695 |
| SMILES | [H][C@@]12Nc3ccccc3N=C1C=CC=C2C(=O)[O-] |
| InChI | InChI=1S/C13H10N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7,12,15H,(H,16,17)/p-1/t12-/m0/s1 |
| InChIKey | XMQOCNWUNJVNBJ-LBPRGKRZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (10aS)-10,10a-dihydrophenazine-1-carboxylate (CHEBI:132003) is a aromatic amino-acid anion (CHEBI:63473) |
| (10aS)-10,10a-dihydrophenazine-1-carboxylate (CHEBI:132003) is a monocarboxylic acid anion (CHEBI:35757) |
| (10aS)-10,10a-dihydrophenazine-1-carboxylate (CHEBI:132003) is conjugate base of (10aS)-10,10a-dihydrophenazine-1-carboxylic acid (CHEBI:132266) |
| Incoming Relation(s) |
| (10aS)-10,10a-dihydrophenazine-1-carboxylic acid (CHEBI:132266) is conjugate acid of (10aS)-10,10a-dihydrophenazine-1-carboxylate (CHEBI:132003) |
| IUPAC Name |
|---|
| (10aS)-10,10a-dihydrophenazine-1-carboxylate |
| UniProt Name | Source |
|---|---|
| (10aS)-10,10a-dihydrophenazine-1-carboxylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19106 | MetaCyc |