EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O5S |
| Net Charge | 0 |
| Average Mass | 363.395 |
| Monoisotopic Mass | 363.08889 |
| SMILES | Cc1c(C(=O)c2cnn(C)c2O)ccc(S(C)(=O)=O)c1C1=NOCC1 |
| InChI | InChI=1S/C16H17N3O5S/c1-9-10(15(20)11-8-17-19(2)16(11)21)4-5-13(25(3,22)23)14(9)12-6-7-24-18-12/h4-5,8,21H,6-7H2,1-3H3 |
| InChIKey | IYMLUHWAJFXAQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| topramezone (CHEBI:131999) has role agrochemical (CHEBI:33286) |
| topramezone (CHEBI:131999) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| topramezone (CHEBI:131999) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| topramezone (CHEBI:131999) has role herbicide (CHEBI:24527) |
| topramezone (CHEBI:131999) is a aromatic ketone (CHEBI:76224) |
| topramezone (CHEBI:131999) is a isoxazoles (CHEBI:55373) |
| topramezone (CHEBI:131999) is a pyrazolone (CHEBI:83328) |
| topramezone (CHEBI:131999) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| [3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-(methylsulfonyl)phenyl](5-hydroxy-1-methyl-1H-pyrazol-4-yl)methanone |
| Synonyms | Source |
|---|---|
| [3-(4,5-dihydro-1,2-oxazol-3-yl)-4-mesyl-o-tolyl](5-hydroxy-1-methylpyrazol-4-yl)methanone | Alan Wood's Pesticides |
| [3-(4,5-dihydro-1,2-oxazol-3-yl)-4-(methanesulfonyl)-2-methylphenyl](5-hydroxy-1-methyl-1H-pyrazol-4-yl)methanone | Alan Wood's Pesticides |
| [3-(4,5-dihydro-3-isoxazolyl)-2-methyl-4-(methylsulfonyl)phenyl](5-hydroxy-1-methyl-1H-pyrazol-4-yl)methanone | Alan Wood's Pesticides |
| benzuocaotong | Alan Wood's Pesticides |
| topramézone | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Armezon | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 686 | PPDB |
| CA2691880 | Patent |
| topramezone | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:210631-68-8 | Alan Wood's Pesticides |
| CAS:210631-68-8 | ChemIDplus |
| Citations |
|---|