EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2O4 |
| Net Charge | -2 |
| Average Mass | 272.260 |
| Monoisotopic Mass | 272.08080 |
| SMILES | [H][C@@]12NC3=C(N=C1CC=C[C@H]2C(=O)[O-])[C@H](C(=O)[O-])C=CC3 |
| InChI | InChI=1S/C14H14N2O4/c17-13(18)7-3-1-5-9-11(7)16-10-6-2-4-8(14(19)20)12(10)15-9/h1-4,7-8,11,16H,5-6H2,(H,17,18)(H,19,20)/p-2/t7-,8-,11+/m1/s1 |
| InChIKey | MUDZFKKAMBPIJZ-XLDPMVHQSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,5aS,6R)-1,4,5,5a,6,9-hexahydrophenazine-1,6-dicarboxylate (CHEBI:131971) is a dicarboxylic acid dianion (CHEBI:28965) |
| (1R,5aS,6R)-1,4,5,5a,6,9-hexahydrophenazine-1,6-dicarboxylate (CHEBI:131971) is conjugate base of (1R,5aS,6R)-1,4,5,5a,6,9-hexahydrophenazine-1,6-dicarboxylic acid (CHEBI:132261) |
| Incoming Relation(s) |
| (1R,5aS,6R)-1,4,5,5a,6,9-hexahydrophenazine-1,6-dicarboxylic acid (CHEBI:132261) is conjugate acid of (1R,5aS,6R)-1,4,5,5a,6,9-hexahydrophenazine-1,6-dicarboxylate (CHEBI:131971) |
| IUPAC Name |
|---|
| (1R,5aS,6R)-1,4,5,5a,6,9-hexahydrophenazine-1,6-dicarboxylate |
| UniProt Name | Source |
|---|---|
| (1R,6R)-1,4,5,5a,6,9-hexahydrophenazine-1,6-dicarboxylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12990 | MetaCyc |
| Citations |
|---|