EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14N2O3 |
| Net Charge | 0 |
| Average Mass | 294.310 |
| Monoisotopic Mass | 294.10044 |
| SMILES | N#C/C(=C\c1ccc(O)c(O)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H14N2O3/c18-10-14(8-13-6-7-15(20)16(21)9-13)17(22)19-11-12-4-2-1-3-5-12/h1-9,20-21H,11H2,(H,19,22)/b14-8+ |
| InChIKey | TUCIOBMMDDOEMM-RIYZIHGNSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). STAT3 inhibitor An inhibitor of signal transducer and activator of transcription 3 (STAT3) |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrphostin B42 (CHEBI:131968) has role anti-inflammatory agent (CHEBI:67079) |
| tyrphostin B42 (CHEBI:131968) has role antioxidant (CHEBI:22586) |
| tyrphostin B42 (CHEBI:131968) has role apoptosis inducer (CHEBI:68495) |
| tyrphostin B42 (CHEBI:131968) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| tyrphostin B42 (CHEBI:131968) has role geroprotector (CHEBI:176497) |
| tyrphostin B42 (CHEBI:131968) has role STAT3 inhibitor (CHEBI:87183) |
| tyrphostin B42 (CHEBI:131968) is a catechols (CHEBI:33566) |
| tyrphostin B42 (CHEBI:131968) is a enamide (CHEBI:51751) |
| tyrphostin B42 (CHEBI:131968) is a monocarboxylic acid amide (CHEBI:29347) |
| tyrphostin B42 (CHEBI:131968) is a nitrile (CHEBI:18379) |
| tyrphostin B42 (CHEBI:131968) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E)-N-benzyl-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| Synonyms | Source |
|---|---|
| AG 490 | SUBMITTER |
| AG-490 | SUBMITTER |
| AG490 | SUBMITTER |
| tyrphostin AG-490 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-42880 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4323263 | Reaxys |
| CAS:133550-30-8 | ChemIDplus |
| Citations |
|---|