EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O3 |
| Net Charge | -1 |
| Average Mass | 319.465 |
| Monoisotopic Mass | 319.22787 |
| SMILES | CCCCC[C@@H]1O[C@@H]1C/C=C\C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O3/c1-2-3-12-15-18-19(23-18)16-13-10-8-6-4-5-7-9-11-14-17-20(21)22/h4,6-7,9-10,13,18-19H,2-3,5,8,11-12,14-17H2,1H3,(H,21,22)/p-1/b6-4-,9-7-,13-10-/t18-,19+/m0/s1 |
| InChIKey | JBSCUHKPLGKXKH-LLZJRKGESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (14R,15S)-EET(1−) (CHEBI:131965) is a 14,15-EET(1−) (CHEBI:84024) |
| (14R,15S)-EET(1−) (CHEBI:131965) is conjugate base of (14R,15S)-EET (CHEBI:132275) |
| (14R,15S)-EET(1−) (CHEBI:131965) is enantiomer of (14S,15R)-EET(1−) (CHEBI:131964) |
| Incoming Relation(s) |
| (14R,15S)-EET (CHEBI:132275) is conjugate acid of (14R,15S)-EET(1−) (CHEBI:131965) |
| (14S,15R)-EET(1−) (CHEBI:131964) is enantiomer of (14R,15S)-EET(1−) (CHEBI:131965) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z)-13-[(2R,3S)-3-pentyloxiran-2-yl]trideca-5,8,11-trienoate |
| Synonyms | Source |
|---|---|
| (14R,15S)-EpETrE(1−) | ChEBI |
| (14R,15S)-epoxy-(5Z,8Z,11Z)-icosatrienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (14R,15S)-epoxy-(5Z,8Z,11Z)-eicosatrienoate | UniProt |
| Citations |
|---|