EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O7P |
| Net Charge | 0 |
| Average Mass | 212.094 |
| Monoisotopic Mass | 212.00859 |
| SMILES | O=C(O)C(O)C(C[PH](=O)O)C(=O)O |
| InChI | InChI=1S/C5H9O7P/c6-3(5(9)10)2(4(7)8)1-13(11)12/h2-3,6,13H,1H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RZQCPFXISXNJHP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces viridochromogenes (ncbitaxon:1938) | - | PubMed (11472937) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phosphinomethylisomalic acid (CHEBI:131959) has role bacterial metabolite (CHEBI:76969) |
| phosphinomethylisomalic acid (CHEBI:131959) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| phosphinomethylisomalic acid (CHEBI:131959) is a phosphinic acids (CHEBI:26044) |
| phosphinomethylisomalic acid (CHEBI:131959) is conjugate acid of phosphinomethylisomalate(3−) (CHEBI:131650) |
| Incoming Relation(s) |
| phosphinomethylisomalate(3−) (CHEBI:131650) is conjugate base of phosphinomethylisomalic acid (CHEBI:131959) |
| IUPAC Name |
|---|
| 2-hydroxy-3-{[hydroxy(oxo)-λ5-phosphanyl]methyl}butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-11744 | MetaCyc |
| Citations |
|---|