EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO3 |
| Net Charge | 0 |
| Average Mass | 179.175 |
| Monoisotopic Mass | 179.05824 |
| SMILES | Nc1ccccc1C(=O)CC(=O)O |
| InChI | InChI=1S/C9H9NO3/c10-7-4-2-1-3-6(7)8(11)5-9(12)13/h1-4H,5,10H2,(H,12,13) |
| InChIKey | POAXUNDIOGWQOC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | - | PubMed (25960261) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminobenzoylacetic acid (CHEBI:131950) has functional parent 3-phenylpropionic acid (CHEBI:28631) |
| 2-aminobenzoylacetic acid (CHEBI:131950) has role bacterial metabolite (CHEBI:76969) |
| 2-aminobenzoylacetic acid (CHEBI:131950) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| 2-aminobenzoylacetic acid (CHEBI:131950) is a substituted aniline (CHEBI:48975) |
| 2-aminobenzoylacetic acid (CHEBI:131950) is conjugate acid of 2-aminobenzoylacetate (CHEBI:131446) |
| Incoming Relation(s) |
| 2-aminobenzoylacetate (CHEBI:131446) is conjugate base of 2-aminobenzoylacetic acid (CHEBI:131950) |
| IUPAC Name |
|---|
| 3-(2-aminophenyl)-3-oxopropanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3259227 | Reaxys |
| Citations |
|---|