EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N4O8 |
| Net Charge | 0 |
| Average Mass | 486.481 |
| Monoisotopic Mass | 486.17506 |
| SMILES | [NH3+][C@H](CCOc1ccc([C@@H]([NH3+])C(=O)N[C@H]2CN([C@@H](C(=O)[O-])c3ccc(O)cc3)C2=O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C23H26N4O8/c24-16(22(31)32)9-10-35-15-7-3-12(4-8-15)18(25)20(29)26-17-11-27(21(17)30)19(23(33)34)13-1-5-14(28)6-2-13/h1-8,16-19,28H,9-11,24-25H2,(H,26,29)(H,31,32)(H,33,34)/t16-,17+,18-,19-/m1/s1 |
| InChIKey | CWTCWGGPTVMMLT-FCGDIQPGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocardicin C dizwitterion (CHEBI:131948) is a α-amino-acid zwitterion (CHEBI:78608) |
| nocardicin C dizwitterion (CHEBI:131948) is tautomer of nocardicin C (CHEBI:81021) |
| Incoming Relation(s) |
| nocardicin C (CHEBI:81021) is tautomer of nocardicin C dizwitterion (CHEBI:131948) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-4-{4-[(1R)-1-azaniumyl-2-({(3S)-1-[(R)-carboxylato(4-hydroxyphenyl)methyl]-2-oxoazetidin-3-yl}amino)-2-oxoethyl]phenoxy}butanoate |
| UniProt Name | Source |
|---|---|
| nocardicin C | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9415 | MetaCyc |