EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19N5O |
| Net Charge | 0 |
| Average Mass | 357.417 |
| Monoisotopic Mass | 357.15896 |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(-c2cccc3nnc(N)c23)cc1 |
| InChI | InChI=1S/C21H19N5O/c1-13-5-2-3-7-17(13)24-21(27)23-15-11-9-14(10-12-15)16-6-4-8-18-19(16)20(22)26-25-18/h2-12H,1H3,(H3,22,25,26)(H2,23,24,27) |
| InChIKey | XTKIFGMBONJHTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-o-tolylurea (CHEBI:131947) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-o-tolylurea (CHEBI:131947) is a aromatic amine (CHEBI:33860) |
| 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-o-tolylurea (CHEBI:131947) is a indazoles (CHEBI:38769) |
| 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-o-tolylurea (CHEBI:131947) is a phenylureas (CHEBI:134043) |
| 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-o-tolylurea (CHEBI:131947) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(2-methylphenyl)urea |
| Synonyms | Source |
|---|---|
| 1-(4-(3-amino-1H-indazol-4-yl)phenyl)-3-o-tolylurea | SUBMITTER |
| N-[4-(3-amino-1H-indazol-4-yl)phenyl]-N''-(2-methylphenyl)-urea | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11008701 | Reaxys |
| CAS:796967-10-7 | SUBMITTER |
| Citations |
|---|