EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25NO8 |
| Net Charge | 0 |
| Average Mass | 335.353 |
| Monoisotopic Mass | 335.15802 |
| SMILES | OCC1=C[C@H](N[C@H]2C[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H25NO8/c16-3-5-1-7(11(20)13(22)9(5)18)15-8-2-6(4-17)10(19)14(23)12(8)21/h1,6-23H,2-4H2/t6-,7+,8+,9-,10-,11+,12+,13+,14+/m1/s1 |
| InChIKey | YCJYNBLLJHFIIW-MBABXGOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | PubMed (16377847) | |
| Streptomyces hygroscopicus subsp. limoneus (ncbitaxon:264445) | - | PubMed (23028689) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. EC 3.2.1.28 (alpha,alpha-trehalase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of α,α-trehalase (EC 2.4.1.28). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| validoxylamine A (CHEBI:131941) has functional parent validamine (CHEBI:30449) |
| validoxylamine A (CHEBI:131941) has role animal metabolite (CHEBI:75767) |
| validoxylamine A (CHEBI:131941) has role antibiotic insecticide (CHEBI:39208) |
| validoxylamine A (CHEBI:131941) has role bacterial metabolite (CHEBI:76969) |
| validoxylamine A (CHEBI:131941) has role EC 3.2.1.28 (α,α-trehalase) inhibitor (CHEBI:83762) |
| validoxylamine A (CHEBI:131941) is a amino cyclitol (CHEBI:61689) |
| validoxylamine A (CHEBI:131941) is a secondary amino compound (CHEBI:50995) |
| validoxylamine A (CHEBI:131941) is conjugate base of validoxylamine A(1+) (CHEBI:111505) |
| Incoming Relation(s) |
| validoxylamine A(1+) (CHEBI:111505) is conjugate acid of validoxylamine A (CHEBI:131941) |
| IUPAC Name |
|---|
| (1S,2S,3R,6S)-4-(hydroxymethyl)-6-{[(1S,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]amino}cyclohex-4-ene-1,2,3-triol |
| Synonym | Source |
|---|---|
| (+)-validoxylamine A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-9669 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2168717 | Reaxys |
| CAS:38665-10-0 | ChemIDplus |
| Citations |
|---|