EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26NO11P |
| Net Charge | 0 |
| Average Mass | 415.332 |
| Monoisotopic Mass | 415.12435 |
| SMILES | O=P(O)(O)OC[C@H]1C[C@H](N[C@H]2C=C(CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H26NO11P/c16-3-5-1-7(11(19)13(21)9(5)17)15-8-2-6(4-26-27(23,24)25)10(18)14(22)12(8)20/h1,6-22H,2-4H2,(H2,23,24,25)/t6-,7+,8+,9-,10-,11+,12+,13+,14+/m1/s1 |
| InChIKey | ZKSTYMJGEHZSFH-MBABXGOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces hygroscopicus subsp. limoneus (ncbitaxon:264445) | - | PubMed (23028689) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| validoxylamine A 7'-phosphate (CHEBI:131938) has role bacterial metabolite (CHEBI:76969) |
| validoxylamine A 7'-phosphate (CHEBI:131938) is a amino cyclitol (CHEBI:61689) |
| validoxylamine A 7'-phosphate (CHEBI:131938) is a cyclitol phosphate (CHEBI:23450) |
| validoxylamine A 7'-phosphate (CHEBI:131938) is a secondary amino compound (CHEBI:50995) |
| validoxylamine A 7'-phosphate (CHEBI:131938) is conjugate acid of validoxylamine A 7'-phosphate(1−) (CHEBI:111504) |
| Incoming Relation(s) |
| validoxylamine A 7'-phosphate(1−) (CHEBI:111504) is conjugate base of validoxylamine A 7'-phosphate (CHEBI:131938) |
| IUPAC Name |
|---|
| [(1R,2R,3S,4S,5S)-2,3,4-trihydroxy-5-{[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl]methyl dihydrogen phosphate |
| Manual Xrefs | Databases |
|---|---|
| CPD-18789 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20199462 | Reaxys |
| Citations |
|---|