EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13N3O2 |
| Net Charge | 0 |
| Average Mass | 327.343 |
| Monoisotopic Mass | 327.10078 |
| SMILES | O=C1NC(c2cnc3ccccc23)=C/C1=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C20H13N3O2/c24-19-13(18-12-6-2-4-8-16(12)22-20(18)25)9-17(23-19)14-10-21-15-7-3-1-5-11(14)15/h1-10,21H,(H,22,25)(H,23,24)/b18-13+ |
| InChIKey | OJUJNNKCVPCATE-QGOAFFKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrobacter freundii (ncbitaxon:546) | - | PubMed (22391969) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (24889673) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxyviolacein (CHEBI:131915) has functional parent proviolacein (CHEBI:131916) |
| deoxyviolacein (CHEBI:131915) has role antibacterial agent (CHEBI:33282) |
| deoxyviolacein (CHEBI:131915) has role antifungal agent (CHEBI:35718) |
| deoxyviolacein (CHEBI:131915) has role bacterial metabolite (CHEBI:76969) |
| deoxyviolacein (CHEBI:131915) is a olefinic compound (CHEBI:78840) |
| deoxyviolacein (CHEBI:131915) is a oxindoles (CHEBI:38459) |
| deoxyviolacein (CHEBI:131915) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (3E)-3-[5-(1H-indol-3-yl)-2-oxo-1,2-dihydro-3H-pyrrol-3-ylidene]-1,3-dihydro-2H-indol-2-one |
| UniProt Name | Source |
|---|---|
| deoxyviolacein | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C21133 | KEGG COMPOUND |
| CPD-14318 | MetaCyc |
| WO2010003304 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10779335 | Reaxys |
| Citations |
|---|