EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13N3O3 |
| Net Charge | 0 |
| Average Mass | 343.342 |
| Monoisotopic Mass | 343.09569 |
| SMILES | O=C1NC(c2cnc3ccc(O)cc23)=C/C1=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C20H13N3O3/c24-10-5-6-15-12(7-10)14(9-21-15)17-8-13(19(25)23-17)18-11-3-1-2-4-16(11)22-20(18)26/h1-9,21,24H,(H,22,26)(H,23,25)/b18-13+ |
| InChIKey | XAPNKXIRQFHCHN-QGOAFFKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chromobacterium violaceum (ncbitaxon:536) | - | PubMed (17176066) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| violacein (CHEBI:131914) has functional parent proviolacein (CHEBI:131916) |
| violacein (CHEBI:131914) has role antibacterial agent (CHEBI:33282) |
| violacein (CHEBI:131914) has role antifungal agent (CHEBI:35718) |
| violacein (CHEBI:131914) has role antineoplastic agent (CHEBI:35610) |
| violacein (CHEBI:131914) has role apoptosis inducer (CHEBI:68495) |
| violacein (CHEBI:131914) has role bacterial metabolite (CHEBI:76969) |
| violacein (CHEBI:131914) is a hydroxyindoles (CHEBI:84729) |
| violacein (CHEBI:131914) is a olefinic compound (CHEBI:78840) |
| violacein (CHEBI:131914) is a oxindoles (CHEBI:38459) |
| violacein (CHEBI:131914) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (3E)-3-[5-(5-hydroxy-1H-indol-3-yl)-2-oxo-1,2-dihydro-3H-pyrrol-3-ylidene]-1,3-dihydro-2H-indol-2-one |
| UniProt Name | Source |
|---|---|
| violacein | UniProt |
| Citations |
|---|