EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13N3O3 |
| Net Charge | 0 |
| Average Mass | 343.342 |
| Monoisotopic Mass | 343.09569 |
| SMILES | O=C1NC(c2cnc3ccc(O)cc23)=C/C1=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C20H13N3O3/c24-10-5-6-15-12(7-10)14(9-21-15)17-8-13(19(25)23-17)18-11-3-1-2-4-16(11)22-20(18)26/h1-9,21,24H,(H,22,26)(H,23,25)/b18-13+ |
| InChIKey | XAPNKXIRQFHCHN-QGOAFFKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chromobacterium violaceum (ncbitaxon:536) | - | PubMed (17176066) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| violacein (CHEBI:131914) has functional parent proviolacein (CHEBI:131916) |
| violacein (CHEBI:131914) has role antibacterial agent (CHEBI:33282) |
| violacein (CHEBI:131914) has role antifungal agent (CHEBI:35718) |
| violacein (CHEBI:131914) has role antineoplastic agent (CHEBI:35610) |
| violacein (CHEBI:131914) has role apoptosis inducer (CHEBI:68495) |
| violacein (CHEBI:131914) has role bacterial metabolite (CHEBI:76969) |
| violacein (CHEBI:131914) is a hydroxyindoles (CHEBI:84729) |
| violacein (CHEBI:131914) is a olefinic compound (CHEBI:78840) |
| violacein (CHEBI:131914) is a oxindoles (CHEBI:38459) |
| violacein (CHEBI:131914) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (3E)-3-[5-(5-hydroxy-1H-indol-3-yl)-2-oxo-1,2-dihydro-3H-pyrrol-3-ylidene]-1,3-dihydro-2H-indol-2-one |
| UniProt Name | Source |
|---|---|
| violacein | UniProt |
| Citations |
|---|