EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O10 |
| Net Charge | 0 |
| Average Mass | 446.408 |
| Monoisotopic Mass | 446.12130 |
| SMILES | COc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(O)c1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H22O10/c1-30-13-7-14-16(11(25)6-12(31-14)9-2-4-10(24)5-3-9)19(27)17(13)22-21(29)20(28)18(26)15(8-23)32-22/h2-7,15,18,20-24,26-29H,8H2,1H3/t15-,18-,20+,21-,22+/m1/s1 |
| InChIKey | ABRULANJVVJLFI-DGHBBABESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aleurites moluccanus (ncbitaxon:123498) | - | PubMed (21660087) | |
| Comastoma pedunculatum (ncbitaxon:156519) | - | PubMed (MED:23234130) | |
| Echinodorus grandiflorus (ncbitaxon:55312) | leaf (BTO:0000713) | PubMed (26692456) | |
| Gentianella acuta (ncbitaxon:510832) | - | PubMed (2608753) | |
| Gentianopsis barbata (ncbitaxon:156522) | - | PubMed (2608753) | |
| Iris gracilipes (ncbitaxon:995794) | |||
| leaf (BTO:0000713) | PubMed (25924524) | ||
| flower (BTO:0000469) | PubMed (25924524) | ||
| Lomatogonium rotatum (ncbitaxon:148625) | - | PubMed (2608753) | |
| Lophatherum gracile (ncbitaxon:29683) | - | PubMed (25527702) | |
| Machaerium hirtum (ncbitaxon:450034) | |||
| branch (BTO:0000148) | PubMed (23126578) | ||
| leaf (BTO:0000713) | PubMed (23126578) | ||
| Ohwia caudata (ncbitaxon:1603716) | - | PubMed (25509297) | |
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS287) | ||
| seed (BTO:0001226) | PubMed (26860358) | ||
| Swertia japonica (ncbitaxon:137129) | - | PubMed (26996316) | |
| Wilbrandia ebracteata (ncbitaxon:703182) | root (BTO:0001188) | PubMed (20678557) | |
| Zantedeschia aethiopica (ncbitaxon:69721) | - | PubMed (25924520) | |
| Ziziphus jujuba var. spinosa (ncbitaxon:714518) | seed (BTO:0001226) | PubMed (26281588) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | adenosine A1 receptor antagonist An antagonist at the A1 receptor. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| swertisin (CHEBI:131838) has functional parent apigenin (CHEBI:18388) |
| swertisin (CHEBI:131838) has role adenosine A1 receptor antagonist (CHEBI:63957) |
| swertisin (CHEBI:131838) has role anti-inflammatory agent (CHEBI:67079) |
| swertisin (CHEBI:131838) has role antioxidant (CHEBI:22586) |
| swertisin (CHEBI:131838) has role hypoglycemic agent (CHEBI:35526) |
| swertisin (CHEBI:131838) has role plant metabolite (CHEBI:76924) |
| swertisin (CHEBI:131838) is a dihydroxyflavone (CHEBI:38686) |
| swertisin (CHEBI:131838) is a flavone C-glycoside (CHEBI:83280) |
| swertisin (CHEBI:131838) is a monomethoxyflavone (CHEBI:25401) |
| swertisin (CHEBI:131838) is a monosaccharide derivative (CHEBI:63367) |
| swertisin (CHEBI:131838) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxo-4H-1-benzopyran-6-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| 5,4'-dihydroxy-7-methoxy-6-C-β-D-glucopyranosyl flavonoside | ChEBI |
| 6-beta-D-Glucopyranosyl-4',5-dihydroxy-7-methoxyflavone | KNApSAcK |
| 6-beta-D-Glucopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | KNApSAcK |
| 6-C-glucopyranosyl-7-O-methylapigenin | ChEBI |
| 7-O-methyl-6-C-β-D-glucopyranosylapigenin | ChEBI |
| 7-O-Methylapigenin 6-C-beta-D-glucopyranoside | KNApSAcK |
| Citations |
|---|