EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O4 |
| Net Charge | 0 |
| Average Mass | 352.515 |
| Monoisotopic Mass | 352.26136 |
| SMILES | [H][C@@]12[C@@H](O)[C@H](O)[C@@](C)(O)[C@H](/C=C/C(C)=C\COC)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C21H36O4/c1-14(10-13-25-6)8-9-15-20(4)12-7-11-19(2,3)17(20)16(22)18(23)21(15,5)24/h8-10,15-18,22-24H,7,11-13H2,1-6H3/b9-8+,14-10-/t15-,16-,17+,18+,20-,21+/m1/s1 |
| InChIKey | KOMLQPBMYPUDGX-GPLUPSNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | PubMed (26860358) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS287) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sterebin L (CHEBI:131837) has role plant metabolite (CHEBI:76924) |
| sterebin L (CHEBI:131837) is a ether (CHEBI:25698) |
| sterebin L (CHEBI:131837) is a labdane diterpenoid (CHEBI:36770) |
| sterebin L (CHEBI:131837) is a olefinic compound (CHEBI:78840) |
| sterebin L (CHEBI:131837) is a secondary alcohol (CHEBI:35681) |
| sterebin L (CHEBI:131837) is a tertiary alcohol (CHEBI:26878) |
| sterebin L (CHEBI:131837) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,4aS,8aS)-4-[(1E,3Z)-5-methoxy-3-methylpenta-1,3-dien-1-yl]-3,4a,8,8-tetramethyldecahydronaphthalene-1,2,3-triol |
| Manual Xrefs | Databases |
|---|---|
| C00045083 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9729242 | Reaxys |
| CAS:638198-85-3 | KNApSAcK |