EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H40O19 |
| Net Charge | 0 |
| Average Mass | 800.719 |
| Monoisotopic Mass | 800.21638 |
| SMILES | COc1cc(/C=C/C(=O)OC[C@H]2O[C@@H](O[C@@H]3[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]3c3c(O)cc4oc(-c5ccc(O)c(OC)c5)cc(=O)c4c3O)[C@H](O)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C38H40O19/c1-51-22-9-15(3-6-17(22)40)4-8-27(44)53-14-26-31(46)33(48)35(50)38(56-26)57-37-34(49)30(45)25(13-39)55-36(37)29-20(43)12-24-28(32(29)47)19(42)11-21(54-24)16-5-7-18(41)23(10-16)52-2/h3-12,25-26,30-31,33-41,43,45-50H,13-14H2,1-2H3/b8-4+/t25-,26-,30-,31-,33+,34+,35-,36+,37-,38+/m1/s1 |
| InChIKey | DJZOTDSGEBENPL-LWHZWZDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | PubMed (26860358) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS287) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoscoparin 2''-O-[6-(E)-feruloylglucoside] (CHEBI:131831) has functional parent isoscoparin (CHEBI:18200) |
| isoscoparin 2''-O-[6-(E)-feruloylglucoside] (CHEBI:131831) has role plant metabolite (CHEBI:76924) |
| isoscoparin 2''-O-[6-(E)-feruloylglucoside] (CHEBI:131831) is a flavone C-glycoside (CHEBI:83280) |
| isoscoparin 2''-O-[6-(E)-feruloylglucoside] (CHEBI:131831) is a monomethoxyflavone (CHEBI:25401) |
| isoscoparin 2''-O-[6-(E)-feruloylglucoside] (CHEBI:131831) is a polyphenol (CHEBI:26195) |
| isoscoparin 2''-O-[6-(E)-feruloylglucoside] (CHEBI:131831) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-1-benzopyran-6-yl]-2-O-{6-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-β-D-glucopyranosyl}-D-glucitol |
| Synonyms | Source |
|---|---|
| 2''-(6-feruloylglucosyl)isoscoparin | ChEBI |
| 2''-O-(6-feruloylglucosyl)isoscoparin | ChEBI |
| 2''-O-[6-(E)-feruloylglucosyl]isoscoparin | ChEBI |
| isoscoparin 2''-[6-(E)-feruloylglucoside] | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00006336 | KNApSAcK |
| LMPK12110753 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8966682 | Reaxys |
| CAS:97605-26-0 | KNApSAcK |