EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O7P |
| Net Charge | 0 |
| Average Mass | 345.208 |
| Monoisotopic Mass | 345.04743 |
| SMILES | [H][C@]12O[C@H](C[C@@H]1O)n1c(nc3c(=O)nc(N)nc31)[C@H]2OP(=O)(O)O |
| InChI | InChI=1S/C10H12N5O7P/c11-10-13-7-4(9(17)14-10)12-8-6(22-23(18,19)20)5-2(16)1-3(21-5)15(7)8/h2-3,5-6,16H,1H2,(H2,18,19,20)(H3,11,13,14,17)/t2-,3+,5-,6-/m0/s1 |
| InChIKey | WUVBJPHCDIFJHL-VPXOEYFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) has functional parent 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) |
| 8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| 8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) is a N-glycosyl compound (CHEBI:21731) |
| 8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) is a aromatic amine (CHEBI:33860) |
| 8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) is a bridged compound (CHEBI:35990) |
| 8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) is a organic heterotetracyclic compound (CHEBI:38163) |
| 8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) is a phosphate monoester (CHEBI:7794) |
| 8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (6R,7S,8S,10R)-2-amino-8-hydroxy-4-oxo-1,6,7,8,9,10-hexahydro-4H-7,10-epoxyazepino[1,2-e]purin-6-yl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| cyclo-dGMP | ChEBI |
| cyclodGMP | ChEBI |
| 8,5'-cyclo-dGMP | ChEBI |
| Citations |
|---|