EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N5O3 |
| Net Charge | 0 |
| Average Mass | 249.230 |
| Monoisotopic Mass | 249.08619 |
| SMILES | [H][C@]12O[C@H](C[C@@H]1O)n1c(nc3c(N)ncnc31)[C@H]2O |
| InChI | InChI=1S/C10H11N5O3/c11-8-5-9(13-2-12-8)15-4-1-3(16)7(18-4)6(17)10(15)14-5/h2-4,6-7,16-17H,1H2,(H2,11,12,13)/t3-,4+,6-,7-/m0/s1 |
| InChIKey | MBVGIEDXZGVICG-FXZMZVCPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,5'-cyclo-2'-deoxyadenosine (CHEBI:131825) has functional parent 2'-deoxyadenosine (CHEBI:17256) |
| 8,5'-cyclo-2'-deoxyadenosine (CHEBI:131825) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| 8,5'-cyclo-2'-deoxyadenosine (CHEBI:131825) is a N-glycosyl compound (CHEBI:21731) |
| 8,5'-cyclo-2'-deoxyadenosine (CHEBI:131825) is a aromatic amine (CHEBI:33860) |
| 8,5'-cyclo-2'-deoxyadenosine (CHEBI:131825) is a bridged compound (CHEBI:35990) |
| 8,5'-cyclo-2'-deoxyadenosine (CHEBI:131825) is a diol (CHEBI:23824) |
| 8,5'-cyclo-2'-deoxyadenosine (CHEBI:131825) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (6R,7S,8S,10R)-4-amino-7,8,9,10-tetrahydro-6H-7,10-epoxyazepino[1,2-e]purine-6,8-diol |
| Synonyms | Source |
|---|---|
| 2'-Deoxy-8,5'-cycloadenosine | ChemIDplus |
| 8,5'-Cda | ChemIDplus |
| cyclodA | ChEBI |
| cyclo-dA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8118367 | Reaxys |
| CAS:117182-88-4 | ChemIDplus |
| Citations |
|---|