EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18NO2 |
| Net Charge | +1 |
| Average Mass | 256.325 |
| Monoisotopic Mass | 256.13321 |
| SMILES | Oc1cc2c(cc1O)[C@@H](c1ccccc1)C[NH2+]CC2 |
| InChI | InChI=1S/C16H17NO2/c18-15-8-12-6-7-17-10-14(13(12)9-16(15)19)11-4-2-1-3-5-11/h1-5,8-9,14,17-19H,6-7,10H2/p+1/t14-/m1/s1 |
| InChIKey | JUDKOGFHZYMDMF-CQSZACIVSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-SKF 38393(1+) (CHEBI:131806) is a ammonium ion derivative (CHEBI:35274) |
| (R)-SKF 38393(1+) (CHEBI:131806) is a organic cation (CHEBI:25697) |
| (R)-SKF 38393(1+) (CHEBI:131806) is conjugate acid of (R)-SKF 38393 (CHEBI:131800) |
| (R)-SKF 38393(1+) (CHEBI:131806) is enantiomer of (S)-SKF 38393(1+) (CHEBI:131807) |
| Incoming Relation(s) |
| (R)-SKF 38393 hydrobromide (CHEBI:131805) has part (R)-SKF 38393(1+) (CHEBI:131806) |
| (R)-SKF 38393 (CHEBI:131800) is conjugate base of (R)-SKF 38393(1+) (CHEBI:131806) |
| (S)-SKF 38393(1+) (CHEBI:131807) is enantiomer of (R)-SKF 38393(1+) (CHEBI:131806) |
| IUPAC Name |
|---|
| (1R)-7,8-dihydroxy-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-3-ium |