EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO2 |
| Net Charge | 0 |
| Average Mass | 255.317 |
| Monoisotopic Mass | 255.12593 |
| SMILES | Oc1cc2c(cc1O)[C@H](c1ccccc1)CNCC2 |
| InChI | InChI=1S/C16H17NO2/c18-15-8-12-6-7-17-10-14(13(12)9-16(15)19)11-4-2-1-3-5-11/h1-5,8-9,14,17-19H,6-7,10H2/t14-/m0/s1 |
| InChIKey | JUDKOGFHZYMDMF-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-SKF 38393 (CHEBI:131796) is a 1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol (CHEBI:131801) |
| (S)-SKF 38393 (CHEBI:131796) is conjugate base of (S)-SKF 38393(1+) (CHEBI:131807) |
| (S)-SKF 38393 (CHEBI:131796) is enantiomer of (R)-SKF 38393 (CHEBI:131800) |
| Incoming Relation(s) |
| SKF 38393 (CHEBI:131793) has part (S)-SKF 38393 (CHEBI:131796) |
| (S)-SKF 38393(1+) (CHEBI:131807) is conjugate acid of (S)-SKF 38393 (CHEBI:131796) |
| (R)-SKF 38393 (CHEBI:131800) is enantiomer of (S)-SKF 38393 (CHEBI:131796) |
| IUPAC Name |
|---|
| (1S)-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
| Synonyms | Source |
|---|---|
| (1S)-2,3,4,5-tetrahydro-1-phenyl-1H-3-benzazepine-7,8-diol | ChemIDplus |
| (S)-SKF-38393 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5287503 | Reaxys |
| CAS:81702-43-4 | ChemIDplus |
| Citations |
|---|