EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O5 |
| Net Charge | 0 |
| Average Mass | 416.558 |
| Monoisotopic Mass | 416.25627 |
| SMILES | [H][C@@]1(OC(=O)C=C(C)C)/C=C/[C@@](C)(CCC=C(C)C)C/C=C(/CO)C(=O)/C=C/[C@@]1(C)O |
| InChI | InChI=1S/C25H36O5/c1-18(2)8-7-12-24(5)13-9-20(17-26)21(27)10-15-25(6,29)22(11-14-24)30-23(28)16-19(3)4/h8-11,14-16,22,26,29H,7,12-13,17H2,1-6H3/b14-11+,15-10+,20-9-/t22-,24+,25-/m1/s1 |
| InChIKey | GYXPHGPELZUVGI-QYGPLFBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Viburnum awabuki (ncbitaxon:453244) | leaf (BTO:0000713) | Article (Kawazu, K., 1980. Isolation of vibsanins A, B, C, D, E, and F from Viburnum odoratissimum . Agric. Biol. Chem. 44, 1367–1372.) | https://www.jstage.jst.go.jp/article/bbb1961/44/6/44_6_1367/_pdf |
| Viburnum suspensum (ncbitaxon:237958) | leaf (BTO:0000713) | PubMed (12150795) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vibsanin B (CHEBI:131781) has functional parent 3-methylbut-2-enoic acid (CHEBI:37127) |
| vibsanin B (CHEBI:131781) has role plant growth retardant (CHEBI:35219) |
| vibsanin B (CHEBI:131781) has role plant metabolite (CHEBI:76924) |
| vibsanin B (CHEBI:131781) is a cyclic terpene ketone (CHEBI:36130) |
| vibsanin B (CHEBI:131781) is a enone (CHEBI:51689) |
| vibsanin B (CHEBI:131781) is a tertiary alcohol (CHEBI:26878) |
| vibsanin B (CHEBI:131781) is a vibsane diterpenoid (CHEBI:131782) |
| IUPAC Name |
|---|
| (1R,2E,4S,6Z,9E,11R)-11-hydroxy-7-(hydroxymethyl)-4,11-dimethyl-4-(4-methylpent-3-en-1-yl)-8-oxocycloundeca-2,6,9-trien-1-yl 3-methylbut-2-enoate |
| Synonym | Source |
|---|---|
| vibsanine B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7831954 | Reaxys |