EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO2 |
| Net Charge | 0 |
| Average Mass | 161.160 |
| Monoisotopic Mass | 161.04768 |
| SMILES | O=C(O)c1ccc2nccc2c1 |
| InChI | InChI=1S/C9H7NO2/c11-9(12)7-1-2-8-6(5-7)3-4-10-8/h1-5,10H,(H,11,12) |
| InChIKey | IENZCGNHSIMFJE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | PubMed (26860358) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS286) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-5-carboxylic acid (CHEBI:131778) has role plant metabolite (CHEBI:76924) |
| indole-5-carboxylic acid (CHEBI:131778) is a indolecarboxylic acid (CHEBI:38610) |
| IUPAC Name |
|---|
| 1H-indole-5-carboxylic acid |
| Citations |
|---|